82204-64-6 Usage
Uses
Used in Cancer Treatment:
α-[(2-Nitro-1H-imidazol-1-yl)methyl]-4-morpholine-1-propanol is used as a hypoxic cell radiosensitizer for enhancing the effectiveness of radiation therapy in cancer treatment. It targets hypoxic cells, which are often resistant to standard radiation therapy, and makes them more susceptible to the treatment, potentially leading to improved outcomes for cancer patients.
Used in Pharmaceutical Development:
In the pharmaceutical industry, α-[(2-Nitro-1H-imidazol-1-yl)methyl]-4-morpholine-1-propanol is used as a potential therapeutic agent for the development of new drugs targeting specific types of cancer. Its unique properties in sensitizing hypoxic cells to radiation make it a promising candidate for further research and development.
Used in Parasitic Infection Treatment:
α-[(2-Nitro-1H-imidazol-1-yl)methyl]-4-morpholine-1-propanol is also being studied for its potential use in treating parasitic infections. Its application in this field is still under investigation, and further research is required to understand its full potential and mechanisms of action against parasites.
Check Digit Verification of cas no
The CAS Registry Mumber 82204-64-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,2,0 and 4 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 82204-64:
(7*8)+(6*2)+(5*2)+(4*0)+(3*4)+(2*6)+(1*4)=106
106 % 10 = 6
So 82204-64-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H18N4O4/c16-10(1-3-13-5-7-19-8-6-13)9-14-4-2-12-11(14)15(17)18/h2,4,10,16H,1,3,5-9H2
