82214-96-8 Usage
General Description
The chemical compound "(2S)-2-[[4-[(3,5-diamino-9-methyl-10-thia-2,4,7-triazabicyclo[4.4.0]deca-1,3,5,7-tetraen-8-yl)methyl-methyl-amino]benzoyl]amino]pentanedioic acid" is a peptide-based molecule containing amino acids and a pentanedioic acid group. It is a complex organic molecule with a long and specific structure, consisting of a central pentanedioic acid core with amino acid groups attached. This chemical compound is not a naturally occurring substance, but rather a synthetic molecule that may be used for pharmaceutical research or other scientific purposes due to its unique structure and potential biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 82214-96-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,2,1 and 4 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 82214-96:
(7*8)+(6*2)+(5*2)+(4*1)+(3*4)+(2*9)+(1*6)=118
118 % 10 = 8
So 82214-96-8 is a valid CAS Registry Number.
InChI:InChI=1/C21H25N7O5S/c1-10-14(24-16-17(22)26-21(23)27-19(16)34-10)9-28(2)12-5-3-11(4-6-12)18(31)25-13(20(32)33)7-8-15(29)30/h3-6,10,13H,7-9H2,1-2H3,(H,25,31)(H,29,30)(H,32,33)(H4,22,23,26,27)/t10?,13-/m0/s1