82331-12-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetic acid is used as a precursor in the pharmaceutical industry for the synthesis of various biologically active compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Medicinal Research:
In the field of medicinal research, 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetic acid is studied for its potential applications in the treatment of certain diseases. Its purine-based structure and sulfur atom attachment may contribute to its biological activity and therapeutic potential.
Used in Drug Development:
2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetic acid is utilized in drug development as a key intermediate in the synthesis of novel therapeutic agents. Its unique chemical properties enable the creation of innovative drugs with potential benefits in various medical conditions.
Used in Biochemical Studies:
In biochemical research, 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetic acid serves as a valuable compound for studying the interactions between purine derivatives and biological systems. Its presence in various assays and experiments helps researchers understand the mechanisms of action and potential applications of purine-based compounds in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 82331-12-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,3,3 and 1 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 82331-12:
(7*8)+(6*2)+(5*3)+(4*3)+(3*1)+(2*1)+(1*2)=102
102 % 10 = 2
So 82331-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N4O4S/c1-12-6-5(7(16)13(2)9(12)17)10-8(11-6)18-3-4(14)15/h3H2,1-2H3,(H,10,11)(H,14,15)
