82381-77-9 Usage
Uses
Used in Pharmaceutical Industry:
5-[(2-methoxyethyl)thio]-1,3,4-thiadiazol-2-amine is used as a potential pharmaceutical agent for its unique molecular structure, which may offer therapeutic benefits in the development of new drugs. The presence of the thiadiazole ring and amine group could provide opportunities for medicinal chemistry modifications, enhancing its bioactivity and selectivity for specific targets.
Used in Agrochemical Industry:
In the agrochemical sector, 5-[(2-methoxyethyl)thio]-1,3,4-thiadiazol-2-amine may be utilized as a precursor or active ingredient in the synthesis of new pesticides or herbicides. Its chemical structure could be tailored to target specific pests or weeds, offering novel solutions to agricultural challenges.
Used in Materials Science:
5-[(2-methoxyethyl)thio]-1,3,4-thiadiazol-2-amine could also find applications in materials science, where its unique structure may contribute to the development of new materials with specific properties. For instance, it could be used in the synthesis of polymers, dyes, or sensors, where its chemical reactivity and functional groups play a crucial role.
Further research and experimentation are necessary to fully explore the potential uses and effects of 5-[(2-methoxyethyl)thio]-1,3,4-thiadiazol-2-amine, as its applications may extend beyond the current understanding of its properties and capabilities.
Check Digit Verification of cas no
The CAS Registry Mumber 82381-77-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,3,8 and 1 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 82381-77:
(7*8)+(6*2)+(5*3)+(4*8)+(3*1)+(2*7)+(1*7)=139
139 % 10 = 9
So 82381-77-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H9N3OS2/c1-9-2-3-10-5-8-7-4(6)11-5/h2-3H2,1H3,(H2,6,7)
