82387-56-2 Usage
Piperazine derivative
A chemical compound derived from piperazine, which is a heterocyclic organic compound structured as a six-membered ring with four carbon atoms and two nitrogen atoms.
Cinnamyl group
A functional group present in the compound, which is derived from cinnamic acid and has a phenyl ring connected to a propene side chain.
Propionanilido acetyl group
Another functional group in the compound, which is formed by the combination of propionic acid and acetic anhydride, resulting in a butanedioyl group with an amide and an ester functional group.
Scientific research and pharmaceutical development
The compound is widely used in these fields, especially for studying central nervous system disorders and developing potential therapeutic agents.
Specific ligand or substrate
The compound functions as a biological receptor or enzyme ligand or substrate, meaning it can bind to or react with specific proteins in the body, making it useful for studying their functions and interactions.
Hydrochloride salt form
The compound's hydrochloride salt form enhances its solubility and stability, making it more suitable for laboratory and pharmaceutical applications.
Crucial role in drug discovery
The compound's unique properties and interactions with other compounds make it an important tool for researchers working on new therapeutic agents and understanding the mechanisms of central nervous system disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 82387-56-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,3,8 and 7 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 82387-56:
(7*8)+(6*2)+(5*3)+(4*8)+(3*7)+(2*5)+(1*6)=152
152 % 10 = 2
So 82387-56-2 is a valid CAS Registry Number.
InChI:InChI=1/C24H29N3O2.ClH/c1-2-23(28)27(22-13-7-4-8-14-22)20-24(29)26-18-16-25(17-19-26)15-9-12-21-10-5-3-6-11-21;/h3-14H,2,15-20H2,1H3;1H/b12-9+;