82392-97-0 Usage
General Description
The chemical "(2S)-2-amino-3-[[(1S)-1-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanyl-butanoyl]carbamoyl]-2-phenyl-ethyl]carbamoyl]propanoic acid" is a complex compound with multiple functional groups. It contains amino acids, including propanoic acid, and is composed of various amino acid residues linked together through peptide bonds. Additionally, it contains an indolyl group and a methylsulfanyl group. The chemical's structure suggests complexity and potential biological activity, as it contains multiple functional groups that could interact with biological molecules and pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 82392-97-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,3,9 and 2 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 82392-97:
(7*8)+(6*2)+(5*3)+(4*9)+(3*2)+(2*9)+(1*7)=150
150 % 10 = 0
So 82392-97-0 is a valid CAS Registry Number.
InChI:InChI=1/C29H36N6O6S/c1-42-12-11-23(34-26(37)20(30)14-18-16-32-22-10-6-5-9-19(18)22)27(38)35-28(39)24(13-17-7-3-2-4-8-17)33-25(36)15-21(31)29(40)41/h2-10,16,20-21,23-24,32H,11-15,30-31H2,1H3,(H,33,36)(H,34,37)(H,40,41)(H,35,38,39)/t20-,21-,23-,24-/m0/s1