82409-34-5 Usage
Molecular structure
1H-1,5,3-Benzodiazaphosphepine, 2,3,4,5-tetrahydro-3-phenyl-, 3-sulfide is a complex compound that contains a benzodiazepine and phosphine structure, along with a sulfur atom bonded to the third position of the molecule.
Heterocyclic compound
It contains a five-membered ring with nitrogen, phosphorus, and sulfur atoms, making it a heterocyclic compound.
Aromatic nature
The presence of the phenyl group adds to the compound's aromatic nature, which may contribute to its stability and potential applications.
Potential applications
Due to its unique structure and properties, this chemical may have potential applications in the fields of organic synthesis and pharmaceutical research.
Complexity
The compound's complex structure, containing both benzodiazepine and phosphine elements, may contribute to its potential uses in various chemical and pharmaceutical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 82409-34-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,4,0 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 82409-34:
(7*8)+(6*2)+(5*4)+(4*0)+(3*9)+(2*3)+(1*4)=125
125 % 10 = 5
So 82409-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H15N2PS/c18-17(12-6-2-1-3-7-12)10-15-13-8-4-5-9-14(13)16-11-17/h1-9,15-16H,10-11H2
