82476-12-8 Usage
Heterocyclic compound
Contains an oxadiazole ring
Utility
Used in the synthesis of pharmaceutical drugs and agrochemicals
Pharmacological properties
Potential use in the treatment of various medical conditions
Building block
Used in the synthesis of various organic compounds
Unique structure
Valuable in medicinal chemistry and organic synthesis
Check Digit Verification of cas no
The CAS Registry Mumber 82476-12-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,4,7 and 6 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 82476-12:
(7*8)+(6*2)+(5*4)+(4*7)+(3*6)+(2*1)+(1*2)=138
138 % 10 = 8
So 82476-12-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClN2O2/c1-13-9-12-11-8(14-9)6-2-4-7(10)5-3-6/h2-5H,1H3