82506-99-8 Usage
Type of Compound
Dioxime derivative
Parent Compound
1-chloro-2-butanone
Functionality
Forms stable complexes with metal ions
Participates in chemical reactions (nucleophilic addition, complexation with metal catalysts)
Applications
Production of other chemicals and pharmaceuticals
Analytical chemistry (metal ion detection and extraction)
Organic synthesis
Importance
Versatile compound with multiple uses in various industries
Contributes to the field of chemistry and chemical engineering
Check Digit Verification of cas no
The CAS Registry Mumber 82506-99-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,5,0 and 6 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 82506-99:
(7*8)+(6*2)+(5*5)+(4*0)+(3*6)+(2*9)+(1*9)=138
138 % 10 = 8
So 82506-99-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H7ClN2O2/c1-3(6-8)4(2-5)7-9/h8-9H,2H2,1H3
