82508-14-3 Usage
Uses
Used in Flavoring Agents:
2-methyl-6-(4-methylidene-1-cyclohex-2-enyl)hept-2-en-4-one is used as a flavoring agent in the food and beverage industry, providing unique taste and aroma profiles to various products.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-methyl-6-(4-methylidene-1-cyclohex-2-enyl)hept-2-en-4-one is used as a potential candidate for the development of new drugs and therapies, leveraging its anti-inflammatory, antioxidant, and antifungal properties for treating various health conditions.
Used in Antifungal Applications:
2-methyl-6-(4-methylidene-1-cyclohex-2-enyl)hept-2-en-4-one is used as an antifungal agent for treating fungal infections due to its ability to inhibit fungal growth and reduce inflammation associated with such infections.
Used in Antioxidant Applications:
As an antioxidant, 2-methyl-6-(4-methylidene-1-cyclohex-2-enyl)hept-2-en-4-one is used to protect cells from oxidative damage, potentially reducing the risk of various diseases and promoting overall health.
Used in Anti-inflammatory Applications:
2-methyl-6-(4-methylidene-1-cyclohex-2-enyl)hept-2-en-4-one is used as an anti-inflammatory agent to reduce inflammation and alleviate pain associated with various inflammatory conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 82508-14-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,5,0 and 8 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 82508-14:
(7*8)+(6*2)+(5*5)+(4*0)+(3*8)+(2*1)+(1*4)=123
123 % 10 = 3
So 82508-14-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H22O/c1-11(2)9-15(16)10-13(4)14-7-5-12(3)6-8-14/h5,7,9,13-14H,3,6,8,10H2,1-2,4H3
