82576-52-1 Usage
Uses
Used in Pharmaceutical Industry:
BENDAZACLYSINE is used as a potential therapeutic agent for its anti-inflammatory and anti-allergic properties, targeting conditions such as allergies and inflammation. Its potential antitumor properties also make it a candidate for the development of new drugs for cancer treatment.
Used in Drug Development Research:
BENDAZACLYSINE is used as a research chemical to explore its potential applications in the development of new drugs for various medical conditions, including inflammatory diseases, allergic reactions, and cancer. Further studies are needed to understand its mechanism of action, safety, and efficacy in clinical settings.
Check Digit Verification of cas no
The CAS Registry Mumber 82576-52-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,5,7 and 6 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 82576-52:
(7*8)+(6*2)+(5*5)+(4*7)+(3*6)+(2*5)+(1*2)=151
151 % 10 = 1
So 82576-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H14N2O3.C6H14N2O2/c19-15(20)11-21-16-13-8-4-5-9-14(13)18(17-16)10-12-6-2-1-3-7-12;7-4-2-1-3-5(8)6(9)10/h1-9H,10-11H2,(H,19,20);5H,1-4,7-8H2,(H,9,10)