82637-57-8 Usage
General Description
The chemical "(S)-2-[(S)-2-((S)-1-Ethoxycarbonyl-3-phenylpropylamino)propionyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid benzyl ester" is a complex compound with a long name. It is an ester derivative of a tetrahydroisoquinoline carboxylic acid. The compound contains multiple functional groups, including an amino group, an ester group, and multiple methoxy groups. It is a chiral compound, with all of its stereocenters being of the S configuration. The exact use and properties of this chemical are not immediately apparent from its name, but it likely has applications in medicinal chemistry or as a building block for the synthesis of other complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 82637-57-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,6,3 and 7 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 82637-57:
(7*8)+(6*2)+(5*6)+(4*3)+(3*7)+(2*5)+(1*7)=148
148 % 10 = 8
So 82637-57-8 is a valid CAS Registry Number.
InChI:InChI=1/C34H40N2O7/c1-5-42-33(38)28(17-16-24-12-8-6-9-13-24)35-23(2)32(37)36-21-27-20-31(41-4)30(40-3)19-26(27)18-29(36)34(39)43-22-25-14-10-7-11-15-25/h6-15,19-20,23,28-29,35H,5,16-18,21-22H2,1-4H3/t23-,28-,29-/m0/s1