826995-60-2 Usage
Uses
Used in Pharmaceutical Industry:
4-Bromo-6-fluorobenzo[b]thiophene-2-carboxylic acid is used as a building block or intermediate in the synthesis of various pharmaceutical compounds. Its unique structural features and potential pharmacological properties make it a valuable component in drug development, contributing to the creation of new medications with specific therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical field, 4-Bromo-6-fluorobenzo[b]thiophene-2-carboxylic acid serves as a key intermediate in the production of pesticides and other agrochemicals. Its incorporation into these products can enhance their effectiveness, selectivity, and safety, leading to improved crop protection and management strategies.
Used in Chemical Research:
4-Bromo-6-fluorobenzo[b]thiophene-2-carboxylic acid is also utilized in various areas of chemical research, including the study of its chemical properties, reactivity, and potential applications in material science. Its unique structure allows researchers to explore new avenues in synthetic chemistry and develop innovative approaches to creating novel compounds with specific functions and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 826995-60-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,2,6,9,9 and 5 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 826995-60:
(8*8)+(7*2)+(6*6)+(5*9)+(4*9)+(3*5)+(2*6)+(1*0)=222
222 % 10 = 2
So 826995-60-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H4BrFO2S/c10-6-1-4(11)2-7-5(6)3-8(14-7)9(12)13/h1-3H,(H,12,13)
