827-81-6 Usage
Uses
Used in Pharmaceutical Industry:
BENZO[1,3]DIOXOLE-2-CARBOXYLIC ACID is utilized as a key building block in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs with potential therapeutic benefits.
Used in Organic Chemistry:
In the field of organic chemistry, BENZO[1,3]DIOXOLE-2-CARBOXYLIC ACID is employed as a reagent and intermediate, facilitating the synthesis of other complex organic compounds and contributing to advancements in chemical research.
Used in Medicinal Research:
BENZO[1,3]DIOXOLE-2-CARBOXYLIC ACID is investigated for its potential anti-inflammatory and antiviral properties, indicating its possible use in the development of treatments for inflammatory conditions and viral infections.
Check Digit Verification of cas no
The CAS Registry Mumber 827-81-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,2 and 7 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 827-81:
(5*8)+(4*2)+(3*7)+(2*8)+(1*1)=86
86 % 10 = 6
So 827-81-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H6O4/c9-7(10)8-11-5-3-1-2-4-6(5)12-8/h1-4,8H,(H,9,10)
