82701-91-5 Usage
Uses
Used in Analytical Chemistry and Biochemistry:
1,7-Phenanthroline-5,6-dione is used as a chelating agent for selectively binding and removing metal ions from solutions. Its ability to form stable complexes with metal ions makes it a useful tool in the analysis and separation of metal ions in various chemical and biological systems.
Used in Synthesis of Coordination Compounds and Metal-Organic Frameworks:
1,7-Phenanthroline-5,6-dione is used as a building block in the synthesis of various coordination compounds and metal-organic frameworks. Its chelating properties enable the formation of stable and well-defined structures with potential applications in catalysis, sensing, and drug delivery.
Used in Disease Treatment:
1,7-Phenanthroline-5,6-dione has been studied for its potential use in the treatment of certain diseases, such as cancer and bacterial infections. Its ability to disrupt metal ion homeostasis in cells can lead to the inhibition of essential cellular processes, making it a promising candidate for therapeutic applications.
Used in Antimicrobial and Antifungal Applications:
1,7-Phenanthroline-5,6-dione has been investigated for its antimicrobial and antifungal properties. Its ability to bind metal ions can disrupt the metal ion-dependent processes in microorganisms, making it a potential candidate for the development of new antimicrobial and antifungal agents.
Check Digit Verification of cas no
The CAS Registry Mumber 82701-91-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,7,0 and 1 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 82701-91:
(7*8)+(6*2)+(5*7)+(4*0)+(3*1)+(2*9)+(1*1)=125
125 % 10 = 5
So 82701-91-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H6N2O2/c15-11-8-4-2-5-13-9(8)7-3-1-6-14-10(7)12(11)16/h1-6H
82701-91-5Relevant academic research and scientific papers
NOVEL ADDITION OF NITROALKANES TO o-QUINONES
Itoh, Shinobu,Nii, Kazumi,Mure, Minae,Ohshiro, Yoshiki
, p. 3975 - 3978 (2007/10/02)
A novel addition reaction of nitroalkanes to o-quinones is found to give 1,3-dioxole derivatives.
