827042-23-9 Usage
Uses
Used in Organic Synthesis:
N,N-Dimethyl-1H-benzotriazole-1-carboximidamide Monohydrochloride is used as a reagent in organic synthesis for its ability to facilitate specific chemical reactions. Its presence can enhance the efficiency and selectivity of certain processes, leading to the formation of desired products with improved yields.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, N,N-Dimethyl-1H-benzotriazole-1-carboximidamide Monohydrochloride is used as a key intermediate in the synthesis of various drug molecules. Its unique chemical properties allow for the creation of new compounds with potential therapeutic applications, contributing to the development of novel medications.
Used in Chemical Research:
N,N-Dimethyl-1H-benzotriazole-1-carboximidamide Monohydrochloride is also utilized in chemical research as a tool to study and understand complex reaction mechanisms. Its involvement in various chemical processes can provide insights into the behavior of different molecules and help researchers develop new strategies for synthesizing complex organic compounds.
Overall, N,N-Dimethyl-1H-benzotriazole-1-carboximidamide Monohydrochloride is a versatile compound with applications in organic synthesis, pharmaceutical development, and chemical research, making it an essential component in the advancement of chemistry and related fields.
Check Digit Verification of cas no
The CAS Registry Mumber 827042-23-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,2,7,0,4 and 2 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 827042-23:
(8*8)+(7*2)+(6*7)+(5*0)+(4*4)+(3*2)+(2*2)+(1*3)=149
149 % 10 = 9
So 827042-23-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N5.ClH/c1-13(2)9(10)14-8-6-4-3-5-7(8)11-12-14;/h3-6,10H,1-2H3;1H
