82885-76-5 Usage
Uses
Used in Pharmaceutical Applications:
(E,E)-3-(2-Methoxy-5-(1-oxo-3-phenyl-2-propenyl)phenyl)-2-propenoic acid is used as an active pharmaceutical ingredient for its potential biological and pharmacological activities. Its unique chemical structure allows it to interact with various biological targets, making it a promising candidate for the development of new drugs.
Used in Research Applications:
In the field of research, (E,E)-3-(2-Methoxy-5-(1-oxo-3-phenyl-2-propenyl)phenyl)-2-propenoic acid serves as a valuable compound for studying its interactions with different biological systems. Its use in research can lead to a better understanding of its potential therapeutic applications and help in the development of novel treatments for various diseases.
Used in Chemical Synthesis:
(E,E)-3-(2-Methoxy-5-(1-oxo-3-phenyl-2-propenyl)phenyl)-2-propenoic acid can also be used as a key intermediate in the synthesis of more complex organic compounds. Its unique structure and reactivity make it a useful building block for the creation of new molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Analytical Chemistry:
Due to its distinct chemical properties, (E,E)-3-(2-Methoxy-5-(1-oxo-3-phenyl-2-propenyl)phenyl)-2-propenoic acid can be employed as a reference compound or standard in analytical chemistry. It can be used to calibrate instruments, validate analytical methods, or as a control in various chemical assays, ensuring the accuracy and reliability of experimental results.
Check Digit Verification of cas no
The CAS Registry Mumber 82885-76-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,8,8 and 5 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 82885-76:
(7*8)+(6*2)+(5*8)+(4*8)+(3*5)+(2*7)+(1*6)=175
175 % 10 = 5
So 82885-76-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H16O4/c1-23-18-11-8-15(13-16(18)9-12-19(21)22)17(20)10-7-14-5-3-2-4-6-14/h2-13H,1H3,(H,21,22)/b10-7+,12-9+
82885-76-5Relevant academic research and scientific papers
New cinnamoyl-cinnamic acid derivative, and its use as pharmaceutical
-
, (2008/06/13)
The present invention relates to a new cinnamoyl-cinnamic acid derivative selected from the group constituted by: (i) the m-cinnamoyl-cinnamic acid derivatives of formula STR1 in which: Xo,X1,X2,X3,X4, which are identical or different, each represent an atom of hydrogen, a halogen, a lower alkyl group, a lower alkoxy group, the group NRR' (where R and R' identical or different, each represent an atom of hydrogen or a lower alkyl group), the group NO2, CF3 or OH; R1 represents an atom of hydrogen or a lower alkyl group; R2 represents an atom of hydrogen or the methyl group; Y represents a group OH, OR3 (where R3 is a lower alkyl group), NRR' (where R and R' are defined as hereinabove) or the group O(CH2)n NR4 R5 (where n is an integer of value 1 to 5--and preferably 2 or 3)--; and R4 and R5, identical or different, each represent an atom of hydrogen, a lower alkyl group and may form with the nitrogen atom to which they are bonded a heterocyclic group of 5 to 7 vertices capable of being substituted and of comprising one or more other heteroatoms such as N and O); (ii) their geometrical isomers; and (iii) their salts. It also relates to its method of preparation and its use as pharmaceutical.
