82935-24-8 Usage
Molecular structure
The compound consists of a 1-ethylpyrrolidine ring with a 3-bromo-2,6-dimethoxybenzamido group attached to the nitrogen atom.
Bromo substituent
The presence of a bromine atom on the benzene ring of the benzamido group.
Dimethoxy substituents
Two methoxy groups attached to the benzene ring of the benzamido group.
Chemical properties
The bromine and dimethoxy substituents on the benzamido group impart specific chemical properties to the compound.
Biological properties
The compound has potential uses in pharmaceutical research and drug development due to its unique structure and properties.
Hydrochloride salt form
The compound is in the form of a hydrochloride salt, which enhances its solubility and stability, making it easier to handle and store.
Check Digit Verification of cas no
The CAS Registry Mumber 82935-24-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,9,3 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 82935-24:
(7*8)+(6*2)+(5*9)+(4*3)+(3*5)+(2*2)+(1*4)=148
148 % 10 = 8
So 82935-24-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H23BrN2O3.ClH/c1-4-19-9-5-6-11(19)10-18-16(20)14-13(21-2)8-7-12(17)15(14)22-3;/h7-8,11H,4-6,9-10H2,1-3H3,(H,18,20);1H
