83089-59-2 Usage
Uses
Used in Agricultural Industry:
(alpha furyl-4 thiazolyl-2) oxamique [French] is used as a fungicide for the purpose of protecting crops such as vegetables, fruits, and ornamental plants from various fungal diseases. Its application helps in controlling diseases like downy mildew, blight, and damping-off, which can significantly impact the health and yield of these crops.
The application of (alpha furyl-4 thiazolyl-2) oxamique [French] in the agricultural industry is primarily through foliar sprays or seed treatments, ensuring the chemical's direct contact with the affected plants and providing a preventive measure against fungal infections. It is crucial to adhere to safety guidelines and regulations when handling and using this chemical to minimize any potential risks to human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 83089-59-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,0,8 and 9 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 83089-59:
(7*8)+(6*3)+(5*0)+(4*8)+(3*9)+(2*5)+(1*9)=152
152 % 10 = 2
So 83089-59-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H6N2O4S/c12-7(8(13)14)11-9-10-5(4-16-9)6-2-1-3-15-6/h1-4H,(H,13,14)(H,10,11,12)
