83198-07-6 Usage
Uses
Used in Pharmaceutical Industry:
Sodium 2,4-difluorobenzoate is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, sodium 2,4-difluorobenzoate serves as an intermediate for the production of agrochemicals. Its properties contribute to the creation of effective pesticides and other agricultural chemicals that enhance crop protection and yield.
Used in Organic Synthesis:
Sodium 2,4-difluorobenzoate is utilized in organic synthesis for the preparation of various organic compounds. Its reactivity and functional groups make it a versatile building block in the synthesis of complex organic molecules.
Used in Material Science:
In the field of material science, sodium 2,4-difluorobenzoate may have potential applications due to its unique chemical properties. It can be used in the development of new materials with specific characteristics, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 83198-07-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,1,9 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 83198-07:
(7*8)+(6*3)+(5*1)+(4*9)+(3*8)+(2*0)+(1*7)=146
146 % 10 = 6
So 83198-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4F2O2.Na/c8-4-1-2-5(7(10)11)6(9)3-4;/h1-3H,(H,10,11);/q;+1/p-1
