833486-92-3 Usage
General Description
2-Isobutoxyphenylboronic acid is a boronic acid compound that is used in organic synthesis and pharmaceutical research. It contains a boron atom attached to a phenyl group and an isobutoxy group, making it a versatile reagent for Suzuki-Miyaura cross-coupling reactions, which are widely used in the synthesis of complex organic molecules. 2-Isobutoxyphenylboronic acid is particularly useful in the formation of carbon-carbon bonds, and its high stability and solubility in organic solvents make it a valuable tool for the development of new drug candidates and other biologically active molecules. Additionally, 2-Isobutoxyphenylboronic acid has been studied for its potential applications in materials science and catalysis. Overall, this chemical plays a crucial role in the advancement of organic chemistry and the discovery of new chemical entities with therapeutic and industrial significance.
Check Digit Verification of cas no
The CAS Registry Mumber 833486-92-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,3,4,8 and 6 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 833486-92:
(8*8)+(7*3)+(6*3)+(5*4)+(4*8)+(3*6)+(2*9)+(1*2)=193
193 % 10 = 3
So 833486-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H15BO3/c1-8(2)7-14-10-6-4-3-5-9(10)11(12)13/h3-6,8,12-13H,7H2,1-2H3
