83471-50-5 Usage
General Description
Alpha-casein (90-95) is the primary protein found in milk and dairy products, comprising 90-95% of the total protein content. It is a rich source of essential amino acids and has a high biological value, making it an important component of the human diet. Alpha-casein is also a key ingredient in the production of various dairy products, including cheese, yogurt, and protein supplements. Its unique properties, such as its ability to form a gel or coagulum, make it a versatile and valuable ingredient in the food industry. Additionally, alpha-casein has been studied for its potential health benefits, including its role in promoting muscle growth and repair.
Check Digit Verification of cas no
The CAS Registry Mumber 83471-50-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,4,7 and 1 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 83471-50:
(7*8)+(6*3)+(5*4)+(4*7)+(3*1)+(2*5)+(1*0)=135
135 % 10 = 5
So 83471-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C38H57N9O9/c1-21(2)16-28(46-36(54)30(19-24-9-13-26(49)14-10-24)45-33(51)27(39)6-5-15-42-38(40)41)34(52)43-20-32(50)44-29(18-23-7-11-25(48)12-8-23)35(53)47-31(37(55)56)17-22(3)4/h7-14,21-22,27-31,48-49H,5-6,15-20,39H2,1-4H3,(H,43,52)(H,44,50)(H,45,51)(H,46,54)(H,47,53)(H,55,56)(H4,40,41,42)/t27-,28-,29-,30-,31-/m0/s1