834868-54-1 Usage
General Description
5-(3-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid is a chemical compound with the molecular formula C11H9N3O3. It is a heterocyclic compound that contains a pyrazole ring and a carboxylic acid group. This chemical has potential applications in pharmaceuticals and drug discovery due to its ability to act as a building block in the synthesis of various biologically active compounds. The presence of the methoxyphenyl group makes it a versatile intermediate for the development of new drugs, and its carboxylic acid functionality allows for it to be easily manipulated for further chemical modifications. Overall, this compound has the potential to be a valuable tool in the development of new pharmaceuticals and medical treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 834868-54-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,4,8,6 and 8 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 834868-54:
(8*8)+(7*3)+(6*4)+(5*8)+(4*6)+(3*8)+(2*5)+(1*4)=211
211 % 10 = 1
So 834868-54-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O3/c1-16-10-5-3-2-4-7(10)8-6-9(11(14)15)13-12-8/h2-6H,1H3,(H,12,13)(H,14,15)
