834868-54-1 Usage
Uses
Used in Pharmaceutical Industry:
5-(3-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid is used as a key intermediate in the synthesis of various biologically active compounds for pharmaceutical applications. Its unique structure and functional groups contribute to the development of new drugs with potential therapeutic benefits.
Used in Drug Discovery:
In the field of drug discovery, 5-(3-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid serves as a valuable building block for the creation of novel drug candidates. Its versatility and chemical properties enable researchers to explore its potential in addressing various medical conditions and improving treatment options.
Used in Chemical Modifications:
5-(3-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid is utilized as a starting material for chemical modifications, allowing researchers to optimize its properties and enhance its therapeutic potential. The carboxylic acid group provides a convenient point for further functionalization, enabling the development of derivatives with improved pharmacological profiles.
Used in Medicinal Chemistry Research:
As a heterocyclic compound with a pyrazole ring and a carboxylic acid group, 5-(3-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid is employed in medicinal chemistry research to investigate its potential as a lead compound or as a structural component in the design of new pharmaceutical agents. Its unique chemical properties and structural features make it an attractive candidate for further exploration and optimization.
Check Digit Verification of cas no
The CAS Registry Mumber 834868-54-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,4,8,6 and 8 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 834868-54:
(8*8)+(7*3)+(6*4)+(5*8)+(4*6)+(3*8)+(2*5)+(1*4)=211
211 % 10 = 1
So 834868-54-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O3/c1-16-10-5-3-2-4-7(10)8-6-9(11(14)15)13-12-8/h2-6H,1H3,(H,12,13)(H,14,15)
