834884-76-3 Usage
Uses
Used in Organic Synthesis:
6-(3-THIENYL)PYRIDINE-2-CARBOXALDEHYDE is used as a key intermediate in organic synthesis for the creation of a variety of complex organic molecules. Its unique structure allows for multiple points of reactivity, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 6-(3-THIENYL)PYRIDINE-2-CARBOXALDEHYDE is used as a starting material for the development of new drugs. Its structural features can be exploited to design molecules with specific biological activities, potentially leading to the discovery of novel therapeutic agents.
Used as a Building Block:
6-(3-THIENYL)PYRIDINE-2-CARBOXALDEHYDE serves as a building block in the synthesis of more complex organic compounds. Its presence in a molecule can impart specific chemical and physical properties, which are essential for the development of advanced materials and specialty chemicals.
It is crucial to handle 6-(3-THIENYL)PYRIDINE-2-CARBOXALDEHYDE with care due to potential hazards associated with it. Further research and testing are necessary to fully comprehend its properties and explore its potential applications comprehensively.
Check Digit Verification of cas no
The CAS Registry Mumber 834884-76-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,4,8,8 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 834884-76:
(8*8)+(7*3)+(6*4)+(5*8)+(4*8)+(3*4)+(2*7)+(1*6)=213
213 % 10 = 3
So 834884-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NOS/c12-6-9-2-1-3-10(11-9)8-4-5-13-7-8/h1-7H
834884-76-3Relevant academic research and scientific papers
2-indolizine Carbamoyl amine compound and its preparation and use
-
Paragraph 0112; 0200-0203, (2020/02/07)
The invention discloses a novel 2-indolizine formylamine derivative. The general formula of the novel 2-indolizine formylamine derivative is as shown in a formula (I), wherein the definition of R is specified in the specification. In addition, the inventi
