834884-82-1 Usage
Description
Methyl 3-(6-formyl-2-pyridinyl)benzoate is a chemical compound with the molecular formula C15H11NO3. It is a benzoyl compound with a methyl ester group and a 6-formyl-2-pyridinyl group attached to a benzoate ring. Its unique structure and properties make it an important intermediate in the synthesis of diverse organic compounds.
Uses
Used in Pharmaceutical Industry:
Methyl 3-(6-formyl-2-pyridinyl)benzoate is used as a building block for the production of various drugs and biologically active molecules. Its unique structure allows it to be incorporated into the design and synthesis of new pharmaceutical compounds, potentially leading to the development of novel treatments for various diseases and conditions.
Used in Organic Synthesis:
Methyl 3-(6-formyl-2-pyridinyl)benzoate is used as a key intermediate in the synthesis of a wide range of organic compounds. Its versatile structure enables it to be used in various organic reactions, facilitating the formation of complex molecules and contributing to the advancement of organic chemistry.
Used in Material Science:
Methyl 3-(6-formyl-2-pyridinyl)benzoate has potential applications in the field of material science. Its unique structure and properties may contribute to the development of new materials with specific characteristics, such as improved stability, reactivity, or selectivity, which can be utilized in various industries.
Used as a Reagent in Chemical Research:
Methyl 3-(6-formyl-2-pyridinyl)benzoate serves as a valuable reagent in chemical research. Its unique structure allows researchers to explore its properties and reactivity, leading to a better understanding of chemical reactions and the development of new synthetic methods and techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 834884-82-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,4,8,8 and 4 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 834884-82:
(8*8)+(7*3)+(6*4)+(5*8)+(4*8)+(3*4)+(2*8)+(1*2)=211
211 % 10 = 1
So 834884-82-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H11NO3/c1-18-14(17)11-5-2-4-10(8-11)13-7-3-6-12(9-16)15-13/h2-9H,1H3
