834885-08-4 Usage
Uses
Used in Research and Scientific Applications:
4,6-Dipropoxysalicylaldehyde, 97%, is used as a synthesis material or intermediate in various chemical reactions for research and scientific purposes. Its unique structure and properties make it a valuable compound in the development of new chemical entities and understanding reaction mechanisms.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4,6-Dipropoxysalicylaldehyde, 97%, is used as a key intermediate in the synthesis of various drug molecules. Its reactivity and functional groups allow for the creation of diverse chemical entities with potential therapeutic applications.
Used in Chemical Synthesis:
4,6-Dipropoxysalicylaldehyde, 97%, is utilized as a building block in the synthesis of complex organic compounds. Its versatility in undergoing various chemical reactions, such as oxidation, reduction, and substitution, makes it a valuable component in the creation of novel molecules with specific properties and applications.
Used in Material Science:
In the field of material science, 4,6-Dipropoxysalicylaldehyde, 97%, can be employed as a precursor for the development of new materials with unique properties. Its ability to form covalent bonds and interact with other molecules can lead to the creation of advanced materials with applications in various industries, such as electronics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 834885-08-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,4,8,8 and 5 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 834885-08:
(8*8)+(7*3)+(6*4)+(5*8)+(4*8)+(3*5)+(2*0)+(1*8)=204
204 % 10 = 4
So 834885-08-4 is a valid CAS Registry Number.
InChI:InChI=1S/C13H18O4/c1-3-5-16-10-7-12(15)11(9-14)13(8-10)17-6-4-2/h7-9,15H,3-6H2,1-2H3
