83521-87-3 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 12 carbon (C) atoms, 14 hydrogen (H) atoms, and 3 sulfur (S) atoms.
Explanation
The compound has a dithiolane ring, which is a four-membered ring containing two sulfur atoms. It also has a phenyl group (a six-membered aromatic ring with alternating single and double carbon-carbon bonds) and a thienyl group (a five-membered aromatic ring with one sulfur atom and alternating single and double carbon-carbon bonds) attached to the dithiolane ring.
3. Heterocyclic Organic Compound
Explanation
A heterocyclic compound is a cyclic compound that contains atoms of at least two different elements as part of its ring structure. In this case, the compound has a dithiolane ring with carbon and sulfur atoms.
Explanation
Due to its unique odor and biological properties, this compound is used in the production of various products, including pharmaceuticals, agrochemicals, and fragrance ingredients.
Explanation
The compound is used as a reagent in organic synthesis to introduce thiol (-SH) and sulfur functionalities into other molecules, which can be useful for creating new compounds with specific properties.
Explanation
The compound has potential applications in the production of various materials, such as polymers, catalysts, and other specialty chemicals, due to its unique chemical structure and properties.
Explanation
The compound has a distinct and unique odor, which contributes to its use in the production of fragrance ingredients.
Explanation
The material provided does not give specific details about the biological properties of the compound, but it is mentioned that these properties contribute to its use in the production of pharmaceuticals and agrochemicals.
Structure
Dithiolane ring with a phenyl and thienyl substituent
Applications
Pharmaceutical, agrochemical, and fragrance ingredients
Use as a Reagent
Introduces thiol and sulfur functionalities into molecules
Potential Applications
Polymers, catalysts, and specialty chemicals
Odor
Unique
Biological Properties
Not specified
Check Digit Verification of cas no
The CAS Registry Mumber 83521-87-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,5,2 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 83521-87:
(7*8)+(6*3)+(5*5)+(4*2)+(3*1)+(2*8)+(1*7)=133
133 % 10 = 3
So 83521-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H12S3/c1-2-5-11(6-3-1)13(15-9-10-16-13)12-7-4-8-14-12/h1-8H,9-10H2
83521-87-3Relevant articles and documents
Comparative radioprotective activity of various pentagonal compounds with two heteroatomes
Robbe,Fernandez,Dubief,et al.
, p. 235 - 243 (2007/10/02)
Various heterocyclic compounds with two heteroatomes were synthesized and their potential radioprotective activity was tested. This study shows the interest of phenylthiazolidines derivatives in chemical radioprotection.
