83721-55-5 Usage
Description
3-chloro-N-[5-[(4-chlorobenzoyl)amino]-9,10-dihydro-4,8-dihydroxy-9,10-dioxo-1-anthryl]benzamide is a complex organic compound characterized by a benzamide group connected to a 1-anthryl moiety through a chain of carbon and nitrogen atoms. The molecule features multiple chlorine and hydroxyl groups, as well as an amino group that is linked to a 4-chlorobenzoyl group. This intricate chemical structure, which includes functional groups often found in pharmaceuticals and organic dyes, suggests potential applications in these fields. Further investigation into the compound's detailed structure and composition is necessary to fully understand its properties and uses.
Uses
Used in Pharmaceutical Industry:
3-chloro-N-[5-[(4-chlorobenzoyl)amino]-9,10-dihydro-4,8-dihydroxy-9,10-dioxo-1-anthryl]benzamide is used as a potential pharmaceutical agent due to its complex structure containing functional groups commonly found in drug molecules. The presence of chlorine, hydroxyl, and amino groups may contribute to its interaction with biological targets, making it a candidate for the development of new therapeutics.
Used in Materials Science:
In the field of materials science, 3-chloro-N-[5-[(4-chlorobenzoyl)amino]-9,10-dihydro-4,8-dihydroxy-9,10-dioxo-1-anthryl]benzamide may be utilized for the development of novel organic dyes or as a component in advanced material systems. 3-chloro-N-[5-[(4-chlorobenzoyl)amino]-9,10-dihydro-4,8-dihydroxy-9,10-dioxo-1-anthryl]benzamide's structural features, including the anthryl group and the presence of multiple functional groups, could provide unique properties that are valuable in creating new materials with specific characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 83721-55-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,7,2 and 1 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 83721-55:
(7*8)+(6*3)+(5*7)+(4*2)+(3*1)+(2*5)+(1*5)=135
135 % 10 = 5
So 83721-55-5 is a valid CAS Registry Number.
InChI:InChI=1/C28H16Cl2N2O6/c29-15-6-4-13(5-7-15)27(37)31-17-8-10-19(33)23-21(17)25(35)24-20(34)11-9-18(22(24)26(23)36)32-28(38)14-2-1-3-16(30)12-14/h1-12,33-34H,(H,31,37)(H,32,38)