83728-78-3 Usage
Uses
Used in Asymmetric Synthesis:
(S)-2-(ethylamino)butan-1-ol is used as a chiral auxiliary for facilitating the formation of chiral molecules in asymmetric synthesis. Its ability to induce chirality simplifies the synthesis of complex molecules and enhances the selectivity of chemical reactions.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, (S)-2-(ethylamino)butan-1-ol is employed as a key component in the synthesis of chiral drugs. Its chiral properties enable the production of enantiomerically pure compounds, which are essential for the development of effective and safe medications.
Used in Agrochemical Industry:
(S)-2-(ethylamino)butan-1-ol is utilized in the agrochemical industry for the synthesis of chiral pesticides and herbicides. Its chiral nature allows for the creation of enantiomerically pure active ingredients, which can improve the efficacy and reduce the environmental impact of these chemicals.
Used in Catalyst Synthesis:
(S)-2-(ethylamino)butan-1-ol is used as a precursor in the synthesis of chiral ligands for catalysis. These ligands are crucial for enantioselective catalysis, a process that enables the production of enantiomerically pure compounds with high selectivity.
Used as a Mild Base in Organic Synthesis:
In organic synthesis, (S)-2-(ethylamino)butan-1-ol serves as a mild base, facilitating various chemical reactions without causing unwanted side reactions or decomposition of sensitive functional groups.
Used as a Polymer Stabilizer:
(S)-2-(ethylamino)butan-1-ol is employed as a stabilizer for polymers, enhancing their thermal stability and resistance to degradation, thereby improving the overall performance and longevity of the polymer materials.
Check Digit Verification of cas no
The CAS Registry Mumber 83728-78-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,7,2 and 8 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 83728-78:
(7*8)+(6*3)+(5*7)+(4*2)+(3*8)+(2*7)+(1*8)=163
163 % 10 = 3
So 83728-78-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H15NO/c1-3-6(5-8)7-4-2/h6-8H,3-5H2,1-2H3/t6-/m0/s1
