837376-49-5 Usage
Description
N-methyl-(5-pyrid-3-ylthien-2-yl)methylamine is a chemical compound with the molecular formula C13H14N2S. It is a derivative of both pyridine and thiol, with a methylamine group attached to the nitrogen atom. N-methyl-(5-pyrid-3-ylthien-2-yl)methylamine is often used in medicinal chemistry for the synthesis of various pharmaceuticals and biologically active molecules. It may also have potential applications in the field of organic synthesis, and as a building block for the creation of novel materials and compounds. The specific properties and potential uses of N-methyl-(5-pyrid-3-ylthien-2-yl)methylamine make it an interesting and relevant compound in the world of chemical research.
Uses
Used in Pharmaceutical Industry:
N-methyl-(5-pyrid-3-ylthien-2-yl)methylamine is used as a key intermediate in the synthesis of various pharmaceuticals and biologically active molecules. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
N-methyl-(5-pyrid-3-ylthien-2-yl)methylamine is used as a building block in organic synthesis, enabling the creation of novel materials and compounds with diverse properties and potential applications.
Used in Chemical Research:
N-methyl-(5-pyrid-3-ylthien-2-yl)methylamine is used as a subject of study in chemical research, where its properties and potential uses are explored to further understand its role in various chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 837376-49-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,7,3,7 and 6 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 837376-49:
(8*8)+(7*3)+(6*7)+(5*3)+(4*7)+(3*6)+(2*4)+(1*9)=205
205 % 10 = 5
So 837376-49-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2S/c1-12-8-10-4-5-11(14-10)9-3-2-6-13-7-9/h2-7,12H,8H2,1H3