83796-18-3 Usage
Chemical structure
The compound has a thiadiazole ring, an amine group, and a phenyl and benzodioxol substituent.
Molecular weight
286.31 g/mol (calculated from the molecular formula)
Appearance
The compound is likely to be a solid, although the specific appearance is not provided in the material.
Application
It is used in organic synthesis and pharmaceutical research.
Biological activities
The compound has potential biological activities and has been studied for its potential as a therapeutic agent.
Research significance
Its unique chemical structure makes it a valuable tool for researchers in the development of new compounds for medicinal and biochemical applications.
Stability
The stability of the compound is not mentioned in the material, but it is generally expected to be stable under normal laboratory conditions.
Solubility
The solubility of the compound is not provided in the material, but it may be soluble in organic solvents like dimethyl sulfoxide (DMSO) or methanol, as is common for many organic compounds.
Synthesis
The synthesis of the compound is not described in the material, but it likely involves the formation of the thiadiazole ring and subsequent functionalization with the amine, phenyl, and benzodioxol groups.
Check Digit Verification of cas no
The CAS Registry Mumber 83796-18-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,7,9 and 6 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 83796-18:
(7*8)+(6*3)+(5*7)+(4*9)+(3*6)+(2*1)+(1*8)=173
173 % 10 = 3
So 83796-18-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H11N3O2S/c1-2-4-11(5-3-1)16-15-18-17-14(21-15)10-6-7-12-13(8-10)20-9-19-12/h1-8H,9H2,(H,16,18)
