83817-54-3 Usage
General Description
2-[[4-(carboxymethoxy)phenyl]thio]benzoic acid is a chemical compound with the molecular formula C16H14O5S. It is a thioether derivative of benzoic acid and contains a carboxymethoxy group attached to a phenyl ring. 2-[[4-(carboxymethoxy)phenyl]thio]benzoic acid has potential applications in the pharmaceutical and agricultural industries due to its various biological activities. It has been studied for its anti-inflammatory, antioxidant, and anti-cancer properties. Additionally, its thioether structure suggests it may have potential as a metal chelator or as a catalyst in organic synthesis. Overall, further research and development may reveal additional uses and potential benefits of 2-[[4-(carboxymethoxy)phenyl]thio]benzoic acid in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 83817-54-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,8,1 and 7 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 83817-54:
(7*8)+(6*3)+(5*8)+(4*1)+(3*7)+(2*5)+(1*4)=153
153 % 10 = 3
So 83817-54-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H12O5S/c16-14(17)9-20-10-5-7-11(8-6-10)21-13-4-2-1-3-12(13)15(18)19/h1-8H,9H2,(H,16,17)(H,18,19)
