83860-41-7 Usage
Main Properties
1. Chemical compound
2. Contains amino, hydroxyl, and methoxy groups
3. Includes a cyclohexyl ring and acetamide moiety
4. Presence of N-methyl and ethylaminomethyl groups
5. Potential biological activity
6. Contains carbonic acid component
Specific Content
1. Amino groups
2. Hydroxyl groups
3. Methoxy groups
4. Cyclohexyl ring
5. Acetamide moiety
6. N-methyl group
7. Ethylaminomethyl group
8. Carbonic acid component
Check Digit Verification of cas no
The CAS Registry Mumber 83860-41-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,8,6 and 0 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 83860-41:
(7*8)+(6*3)+(5*8)+(4*6)+(3*0)+(2*4)+(1*1)=147
147 % 10 = 7
So 83860-41-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H37N5O5.CH2O3/c1-4-22-9-10-5-6-11(20)18(27-10)28-17-12(21)7-13(26-3)15(16(17)25)23(2)14(24)8-19;2-1(3)4/h10-13,15-18,22,25H,4-9,19-21H2,1-3H3;(H2,2,3,4)
83860-41-7Relevant articles and documents
ISOLATION AND STRUCTURES OF ISTAMYCIN COMPONENTS
Ikeda, Daishiro,Horiuchi, Yukio,Yoshida, Makoto,Miyasaka,Tsuyoshi,Kondo, Shinichi,Umezawa, Hamao
, p. 33 - 46 (2007/10/02)
In addition to istamycin A and B previously isolated from culture filtrates of Streptomyces tenjimariensis, istomycin C, A0, B0, C0, A1, B1, C1, and A2 which contain the 1,4-diam