83865-95-6 Usage
Explanation
Different sources of media describe the Explanation of 83865-95-6 differently. You can refer to the following data:
1. The compound consists of 16 carbon atoms, 28 hydrogen atoms, 1 fluorine atom, 3 nitrogen atoms, and 4 oxygen atoms.
2. The sum of the atomic weights of all the atoms in the molecule.
3. The compound contains four amino groups (-NH2), which are basic and can form hydrogen bonds.
4. Two hydroxyl groups (-OH) are present, which can also form hydrogen bonds and participate in酸碱反应.
5. A single fluorine atom (-F) is attached to the cyclohexyl ring, which can influence the compound's electronic properties and reactivity.
6. A methyl group (-CH3) is attached to the N-methylacetamide moiety, which can affect steric hindrance and lipophilicity.
7. The compound is derived from N-methylacetamide, which is a common functional group found in many pharmaceuticals and peptides.
8. The compound contains multiple amine (-NH2) and oxane (cyclic ether) groups, which can be useful in drug development and biochemical research.
9. Due to its structural complexity and diversity of functional groups, the compound may be suitable for pharmaceutical applications, such as drug development or biochemical research.
Molecular weight
369.4 g/mol
Amino groups
4
Hydroxyl group
2
Fluoro group
1
Methyl group
1
Cyclic structure
Cyclohexyl ring
Acetamide moiety
N-methylacetamide
Amine and oxane groups
Multiple
Pharmaceutical applications
Potential
Check Digit Verification of cas no
The CAS Registry Mumber 83865-95-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,8,6 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 83865-95:
(7*8)+(6*3)+(5*8)+(4*6)+(3*5)+(2*9)+(1*5)=176
176 % 10 = 6
So 83865-95-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H32FN5O4/c1-7(19)11-4-3-9(20)16(25-11)26-15-10(21)5-8(17)13(14(15)24)22(2)12(23)6-18/h7-11,13-16,24H,3-6,18-21H2,1-2H3