83898-05-9 Usage
General Description
2,5,8,11,14,17-hexaazaoctadecanediamidine dihydrochloride is a chemical compound with the molecular formula C15H42Cl2N6. It is a diamidine derivative and consists of a long chain of carbon atoms with alternating nitrogen atoms and hydrogen atoms. The dihydrochloride form of the compound indicates that it contains two chloride ions, which are important for its solubility and stability. 2,5,8,11,14,17-hexaazaoctadecanediamidine dihydrochloride has potential applications in the pharmaceutical industry, particularly as an antibacterial or antifungal agent due to its ability to disrupt nucleic acid synthesis in microorganisms. Additionally, its cationic nature may make it useful for certain electrochemical processes or as a component in materials with specific electronic or magnetic properties. Overall, 2,5,8,11,14,17-hexaazaoctadecanediamidine dihydrochloride is a complex molecule with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 83898-05-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,8,9 and 8 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 83898-05:
(7*8)+(6*3)+(5*8)+(4*9)+(3*8)+(2*0)+(1*5)=179
179 % 10 = 9
So 83898-05-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H32N10.2ClH/c13-11(14)21-9-7-19-5-3-17-1-2-18-4-6-20-8-10-22-12(15)16;;/h17-20H,1-10H2,(H4,13,14,21)(H4,15,16,22);2*1H
