83898-08-2 Usage
General Description
2,5,8,11-tetraazadodecanediamidine dihydrochloride is a chemical compound with the molecular formula C10H24N10Cl2. It is a dihydrochloride salt of the diaminidine compound and is often used as a bacteriostatic agent in various applications. The compound has a strong positive charge due to the presence of four guanidine groups, which allows it to interact with negatively charged molecules such as nucleic acids and proteins. This interaction can inhibit the growth and reproduction of bacteria, making the compound useful in the development of antimicrobial treatments. Additionally, 2,5,8,11-tetraazadodecanediamidine dihydrochloride has also been studied for its potential antiviral and antiparasitic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 83898-08-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,8,9 and 8 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 83898-08:
(7*8)+(6*3)+(5*8)+(4*9)+(3*8)+(2*0)+(1*8)=182
182 % 10 = 2
So 83898-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H22N8.2ClH/c9-7(10)15-5-3-13-1-2-14-4-6-16-8(11)12;;/h13-14H,1-6H2,(H4,9,10,15)(H4,11,12,16);2*1H
