83939-58-6 Usage
Description
2-CHLORO-4-METHYL-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE is a heterocyclic chemical compound with the molecular formula C8H10ClN. It features a cyclopentane ring fused to a pyridine ring, with a chloro group at the 2-position and a methyl group at the 4-position of the cyclopentane ring.
Uses
Used in Pharmaceutical Industry:
2-CHLORO-4-METHYL-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE is used as a key intermediate in the synthesis of various bioactive molecules and medicinal drugs. Its unique structure allows for the development of compounds with potential therapeutic applications.
Used in Organic Chemistry:
In the field of organic chemistry, 2-CHLORO-4-METHYL-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE serves as a valuable building block for the preparation of new chemical compounds. Its versatile structure can be further modified to create a range of novel molecules for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 83939-58-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,9,3 and 9 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 83939-58:
(7*8)+(6*3)+(5*9)+(4*3)+(3*9)+(2*5)+(1*8)=176
176 % 10 = 6
So 83939-58-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H10ClN/c1-6-5-9(10)11-8-4-2-3-7(6)8/h5H,2-4H2,1H3
