83969-03-3 Usage
Chemical structure
2-[[(4-methoxyphenyl)methylhydrazono]methyl]-1,3,3-trimethyl-5-nitro-3H-indolium acetate has a complex structure with a 1,3,3-trimethyl-5-nitro-3H-indolium core, a 4-methoxyphenylmethylhydrazono group, and an acetate functional group.
Core
The core of the compound is a 1,3,3-trimethyl-5-nitro-3H-indolium, which provides the basic framework for the compound and influences its chemical properties.
Substitution
The core is substituted with a 4-methoxyphenylmethylhydrazono group, which is responsible for the compound's unique chemical reactivity and potential applications.
Functional group
The compound is associated with an acetate functional group, which can participate in various chemical reactions and contribute to the compound's properties.
Potential applications
Due to its unique structure and properties, 2-[[(4-methoxyphenyl)methylhydrazono]methyl]-1,3,3-trimethyl-5-nitro-3H-indolium acetate may have potential applications in various fields, such as pharmaceuticals, dyes, and organic synthesis.
Further research
More research and analysis are needed to fully understand the compound's potential uses and effects, as well as its behavior in different chemical reactions and environments.
Check Digit Verification of cas no
The CAS Registry Mumber 83969-03-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,9,6 and 9 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 83969-03:
(7*8)+(6*3)+(5*9)+(4*6)+(3*9)+(2*0)+(1*3)=173
173 % 10 = 3
So 83969-03-3 is a valid CAS Registry Number.
InChI:InChI=1/C20H23N4O3.C2H4O2/c1-20(2)17-12-15(24(25)26)8-11-18(17)22(3)19(20)13-21-23(4)14-6-9-16(27-5)10-7-14;1-2(3)4/h6-13H,1-5H3;1H3,(H,3,4)/q+1;/p-1