839720-60-4 Usage
Uses
Used in Organic Synthesis:
5-Methyl-2-phenyl-1,3,2 dioxaborinane-5-carboxylic acid is used as a boronic ester in organic synthesis for its ability to form stable boron-carbon bonds, which is crucial in the construction of complex organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-Methyl-2-phenyl-1,3,2 dioxaborinane-5-carboxylic acid is used as a building block for the development of new pharmaceutical compounds. Its unique structure and bonding capabilities allow for the creation of novel drug candidates with potential therapeutic applications.
Used in Research and Development:
5-Methyl-2-phenyl-1,3,2 dioxaborinane-5-carboxylic acid is utilized in research and development settings to explore its potential applications and characteristics. As its specific uses are not widely documented, ongoing research is essential to understand its full potential in various industries, such as pharmaceuticals, materials science, and chemical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 839720-60-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,9,7,2 and 0 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 839720-60:
(8*8)+(7*3)+(6*9)+(5*7)+(4*2)+(3*0)+(2*6)+(1*0)=194
194 % 10 = 4
So 839720-60-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H13BO4/c1-11(10(13)14)7-15-12(16-8-11)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,13,14)
839720-60-4Relevant academic research and scientific papers
COMPOUND FOR ORGANIC SYNTHETIC REACTION
-
Paragraph 0026; 0027, (2019/05/01)
PROBLEM TO BE SOLVED: To provide a compound for organic synthetic reaction capable of reducing unnecessary reaction byproduct and generating a targeted chemical reaction effectively, even when a base compound sensitive to basicity is used. SOLUTION: There is provided a compound for organic synthetic reaction which is used for a coupling reaction or an addition reaction forming a bond between carbon-carbon, and is a compound represented by the structure formula (1) or a salt thereof. In the formula, (A) represents an oxygen atom or a nitrogen atom, R1 represents a substituent containing one or more carbon atom, R2 represents a substituent containing one or more carbon atom, hydrogen or halogen, and R1 and R2 may be the same or different each other. SELECTED DRAWING: Figure 2 COPYRIGHT: (C)2019,JPOandINPIT
Regioselective synthesis of CCI-779
-
Page/Page column 5; 7, (2010/02/10)
A method for regioselective synthesis of CCl-779 based on boronate chemistry is provided. Also provided are novel intermediates useful in this method.
