84080-55-7 Usage
General Description
The chemical "(6R,7R)-7-[[(2Z)-2-(carboxymethoxyamino)-2-pyrazol-3-ylidene-acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid" is a complex compound with a molecular structure that includes a pyrazol-3-ylidene-acetyl group, a tetrazol-5-ylsulfanylmethyl group, and a 1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid moiety. This chemical is a potent antibacterial agent and is commonly used in the treatment of various bacterial infections. It works by inhibiting the growth and proliferation of bacteria in the body, ultimately leading to the eradication of the infection. Additionally, it has been found to have good stability and effectiveness in various formulations, making it a valuable tool in the fight against bacterial diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 84080-55-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,0,8 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 84080-55:
(7*8)+(6*4)+(5*0)+(4*8)+(3*0)+(2*5)+(1*5)=127
127 % 10 = 7
So 84080-55-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H17N9O7S2/c1-25-17(21-23-24-25)35-6-7-5-34-15-11(14(30)26(15)12(7)16(31)32)19-13(29)10(8-2-3-18-20-8)22-33-4-9(27)28/h2-3,11,15,22H,4-6H2,1H3,(H,19,29)(H,27,28)(H,31,32)/b10-8-/t11-,15-/m1/s1