84100-51-6 Usage
Uses
Used in Organic Synthesis:
4-(methylamino)piperidine-4-carboxamide is used as a building block in organic synthesis for the creation of various biologically active compounds. Its unique structure allows for the development of new molecules with potential therapeutic properties.
Used in Pharmaceutical Research:
In pharmaceutical research, 4-(methylamino)piperidine-4-carboxamide is utilized as a key component in the synthesis of drug candidates. Its presence in these molecules can contribute to their pharmacological activity, making it a valuable asset in the discovery of new drugs.
Used in Drug Development:
4-(methylamino)piperidine-4-carboxamide holds potential in drug development due to its ability to be incorporated into compounds with therapeutic effects. Its role in the synthesis of biologically active molecules makes it a promising candidate for the development of new medications.
Used in Medicinal Chemistry:
4-(methylamino)piperidine-4-carboxamide is also used in medicinal chemistry for the design and synthesis of molecules with specific biological targets. Its structural features can be manipulated to enhance the potency and selectivity of drug candidates, contributing to advancements in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 84100-51-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,1,0 and 0 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 84100-51:
(7*8)+(6*4)+(5*1)+(4*0)+(3*0)+(2*5)+(1*1)=96
96 % 10 = 6
So 84100-51-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H15N3O/c1-9-7(6(8)11)2-4-10-5-3-7/h9-10H,2-5H2,1H3,(H2,8,11)
84100-51-6Relevant academic research and scientific papers
2-AMINOTHIAZOLE-4-CARBOXYLIC AMIDES AS PROTEIN KINASE INHIBITORS
-
Page/Page column 99, (2008/12/05)
The present invention relates to novel Anilinopiperazine Derivatives of formula (I), compositions comprising the Anilinopiperazine Derivatives, and methods for using the Anilinopiperazine Derivatives for treating or preventing a proliferative disorder, an anti-proliferative disorder, inflammation, arthritis, a central nervous system disorder, a cardiovascular disease, alopecia, a neuronal disease, an ischemic injury, a viral disease, a fungal infection, or a disorder related to the activity of a protein kinase.
