84100-55-0 Usage
Molecular Structure
2,3-dihydro-6-nitroimidazo[2,1-b]benzothiazole is a chemical compound with a complex molecular structure that contains a nitro group, an imidazole ring, and a benzothiazole ring.
Classification
It is an organic compound.
Pharmacological Properties
It has potential pharmacological properties and has been studied for its potential use in medicine, particularly in the treatment of various diseases.
Industrial Applications
It has also been investigated for its potential use in organic synthesis and as a starting material for the preparation of other organic compounds.
Unique Structure
Its unique structure and potential applications make it an area of interest for further research and development in the fields of chemistry and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 84100-55-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,1,0 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 84100-55:
(7*8)+(6*4)+(5*1)+(4*0)+(3*0)+(2*5)+(1*5)=100
100 % 10 = 0
So 84100-55-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3O2S/c13-12(14)6-1-2-8-7(5-6)11-4-3-10-9(11)15-8/h1-2,5H,3-4H2
