841297-69-6 Usage
Uses
Used in Pharmaceutical Industry:
2-phenylquinoline-7-carboxylic acid is used as a therapeutic agent for its potential biological activities. It is being investigated for its potential to treat various diseases and conditions, given its unique chemical structure and properties.
Used in Organic Synthesis:
2-phenylquinoline-7-carboxylic acid is used as a valuable building block for the synthesis of other interesting molecules. Its unique structure and functional groups make it a promising candidate for the development of new compounds with diverse applications in various fields.
Used in Research and Development:
2-phenylquinoline-7-carboxylic acid is used as a subject of research to explore its potential applications and properties. Scientists and researchers are investigating its biological activities, therapeutic potential, and its role as a building block in the synthesis of new molecules, contributing to the advancement of pharmaceuticals and organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 841297-69-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,1,2,9 and 7 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 841297-69:
(8*8)+(7*4)+(6*1)+(5*2)+(4*9)+(3*7)+(2*6)+(1*9)=186
186 % 10 = 6
So 841297-69-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H11NO2/c18-16(19)13-7-6-12-8-9-14(17-15(12)10-13)11-4-2-1-3-5-11/h1-10H,(H,18,19)
