84145-41-5 Usage
General Description
(Z)-N-Ethyl-2-(6-methyl-3-pyridyl)vinylamine is a chemical compound with the molecular formula C12H15N. It is a vinylamine derivative, which is commonly used in the synthesis of pharmaceuticals and agrochemicals. (Z)-N-Ethyl-2-(6-methyl-3-pyridyl)vinylamine has a trans configuration, with the ethyl and methyl-pyridyl groups positioned opposite each other on the carbon-carbon double bond. The presence of the vinylamine group makes it a valuable building block for the synthesis of various organic compounds. Additionally, the (Z) configuration of the compound gives it specific stereochemical properties that are important for its reactivity and biological activity. Overall, (Z)-N-Ethyl-2-(6-methyl-3-pyridyl)vinylamine has potential applications in the development of new drugs and agrochemicals due to its unique molecular structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 84145-41-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,1,4 and 5 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 84145-41:
(7*8)+(6*4)+(5*1)+(4*4)+(3*5)+(2*4)+(1*1)=125
125 % 10 = 5
So 84145-41-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2/c1-3-11-7-6-10-5-4-9(2)12-8-10/h4-8,11H,3H2,1-2H3/b7-6-
