84196-21-4 Usage
General Description
The chemical compound "[4-[(4-chlorophenyl)cyanomethyl]-5-chloro-2-isopropylphenyl]ammonium chloride" is a quaternary ammonium salt with a complex structure containing chlorophenyl, cyanomethyl, and isopropyl groups. It is used as a pharmaceutical intermediate and in the synthesis of various organic compounds. [4-[(4-chlorophenyl)cyanomethyl]-5-chloro-2-isopropylphenyl]ammonium chloride has potential applications in the development of drugs and agrochemicals due to its versatile chemical structure. The ammonium chloride salt form makes it suitable for use in various reactions and processes, and it serves as a valuable reagent in chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 84196-21-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,1,9 and 6 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 84196-21:
(7*8)+(6*4)+(5*1)+(4*9)+(3*6)+(2*2)+(1*1)=144
144 % 10 = 4
So 84196-21-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H16Cl2N2.ClH/c1-10(2)13-7-14(16(19)8-17(13)21)15(9-20)11-3-5-12(18)6-4-11;/h3-8,10,15H,21H2,1-2H3;1H