84218-45-1 Usage
3,4-Dihydro
The presence of two hydrogen atoms attached to the isoquinoline ring, indicating a reduced form of the compound and potentially affecting its reactivity and properties.
6,7-Dimethoxy
Two methoxy groups (-OCH3) attached to the isoquinoline ring at the 6 and 7 positions, which can influence the compound's solubility, stability, and interaction with other molecules.
1-(1H-indol-3-ylmethyl)
A 1H-indol-3-ylmethyl group (a derivative of the indole ring system) attached to the nitrogen atom. This group can influence the compound's solubility, stability, and interaction with other molecules, as well as contribute to its potential biological activity.
Amine functional group
A nitrogen atom bonded to a hydrogen atom and an alkyl group (in this case, the 1-(1H-indol-3-ylmethyl) group). The amine group can participate in hydrogen bonding and other interactions, which can affect the compound's solubility, stability, and biological activity.
Specific uses and properties
The specific uses and properties of this compound would depend on the context of its intended application, such as its potential role in drug development, therapeutic interventions, or chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 84218-45-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,1 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 84218-45:
(7*8)+(6*4)+(5*2)+(4*1)+(3*8)+(2*4)+(1*5)=131
131 % 10 = 1
So 84218-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C31H37N3O4/c1-35-28-10-9-21(15-29(28)36-2)11-13-32-20-34-14-12-22-17-30(37-3)31(38-4)18-25(22)27(34)16-23-19-33-26-8-6-5-7-24(23)26/h5-10,15,17-19,27,32-33H,11-14,16,20H2,1-4H3
84218-45-1Relevant articles and documents
Antiinflammatory and antiproteolytic activities of newer indolyl isoquinolines
Tandon,Tandon,Barthwal,Bhalla,Bhargava
, p. 1233 - 1235 (2007/10/02)
Several indolyl isoquinoline derivatives were synthesized and evaluated for their antiinflammatory and antiproteolytic activities. These derivatives possessed 9.2-32.4% inhibition at a dose of 100 mg/kg i.p. against carrageenin-induced oedema. Four of the