84249-76-3 Usage
Heterocyclic compound
Yes
It contains a ring structure made up of both carbon and other elements (nitrogen, oxygen, and sulfur).
Oxadiazole ring
Present
A five-membered ring with two oxygen atoms and one nitrogen atom.
Thione functional group
Present
A sulfur-containing functional group with a double-bonded sulfur atom and a single-bonded sulfur atom.
4-Methoxyphenylamino group
Connected to the oxadiazole ring
An aromatic group with a methoxy (-OCH3) substituent at the para position and an amino (-NH2) group attached to the benzene ring.
4-Pyridinyl group
Connected to the oxadiazole ring
A heterocyclic group with a pyridine ring (a six-membered nitrogen-containing ring) and a substituent at the para position.
Potential applications
Pharmaceuticals, agrochemicals, or materials science
Due to its complex structure and potential for diverse chemical interactions, 1,3,4-Oxadiazole-2(3H)-thione, 3-(((4-methoxyphenyl)amino)methyl)-5-(4 -pyridinyl)- may have uses in various industries.
Further research needed
Yes
To determine the specific properties and potential uses of 1,3,4-Oxadiazole-2(3H)-thione, 3-(((4-methoxyphenyl)amino)methyl)-5-(4 -pyridinyl)-, additional research and investigation are required.
Check Digit Verification of cas no
The CAS Registry Mumber 84249-76-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,4 and 9 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 84249-76:
(7*8)+(6*4)+(5*2)+(4*4)+(3*9)+(2*7)+(1*6)=153
153 % 10 = 3
So 84249-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H14N4O2S/c1-20-13-4-2-12(3-5-13)17-10-19-15(22)21-14(18-19)11-6-8-16-9-7-11/h2-9,17H,10H2,1H3
