84249-76-3 Usage
Heterocyclic compound
Yes
It contains a ring structure made up of both carbon and other elements (nitrogen, oxygen, and sulfur).
Oxadiazole ring
Present
A five-membered ring with two oxygen atoms and one nitrogen atom.
Thione functional group
Present
A sulfur-containing functional group with a double-bonded sulfur atom and a single-bonded sulfur atom.
4-Methoxyphenylamino group
Connected to the oxadiazole ring
An aromatic group with a methoxy (-OCH3) substituent at the para position and an amino (-NH2) group attached to the benzene ring.
4-Pyridinyl group
Connected to the oxadiazole ring
A heterocyclic group with a pyridine ring (a six-membered nitrogen-containing ring) and a substituent at the para position.
Potential applications
Pharmaceuticals, agrochemicals, or materials science
Due to its complex structure and potential for diverse chemical interactions, this compound may have uses in various industries.
Further research needed
Yes
To determine the specific properties and potential uses of this compound, additional research and investigation are required.
Check Digit Verification of cas no
The CAS Registry Mumber 84249-76-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,4 and 9 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 84249-76:
(7*8)+(6*4)+(5*2)+(4*4)+(3*9)+(2*7)+(1*6)=153
153 % 10 = 3
So 84249-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H14N4O2S/c1-20-13-4-2-12(3-5-13)17-10-19-15(22)21-14(18-19)11-6-8-16-9-7-11/h2-9,17H,10H2,1H3
