84254-93-3 Usage
Uses
Used in Organic Synthesis:
2,4-dichloro-6-methoxyanilinium chloride is used as a reagent in organic synthesis for its versatile chemical properties, enabling the creation of a variety of compounds with diverse applications.
Used in Chemical Research:
In the field of chemical research, 2,4-dichloro-6-methoxyanilinium chloride serves as a valuable compound for studying the effects of substituents on the chemical behavior of aniline derivatives.
Used in Dye Production:
2,4-dichloro-6-methoxyanilinium chloride is utilized as an intermediate in the production of various dyes, contributing to the development of colorants for different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 2,4-dichloro-6-methoxyanilinium chloride is employed as a building block for the synthesis of specific drugs, playing a crucial role in the development of new medicinal compounds.
Used in Pesticide Formulation:
2,4-dichloro-6-methoxyanilinium chloride is also used in the formulation of pesticides, where its chemical properties contribute to the effectiveness of these agricultural chemicals in controlling pests and diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 84254-93-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,5 and 4 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 84254-93:
(7*8)+(6*4)+(5*2)+(4*5)+(3*4)+(2*9)+(1*3)=143
143 % 10 = 3
So 84254-93-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7Cl2NO.ClH/c1-11-6-3-4(8)2-5(9)7(6)10;/h2-3H,10H2,1H3;1H
