84255-04-9 Usage
Main Properties
Contains a benzimidazole ring
Includes a phenylacetamide group
Possesses a propylamine side chain
Features a hydroxypropoxy linker
Likely to have pharmaceutical or medicinal applications
Potential Applications
Pharmaceutical or medicinal uses, possibly as a drug candidate
Suggested biological activity, such as antiparasitic or antifungal potential
Further Research
Necessary to determine specific properties and potential applications
Check Digit Verification of cas no
The CAS Registry Mumber 84255-04-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,5 and 5 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 84255-04:
(7*8)+(6*4)+(5*2)+(4*5)+(3*5)+(2*0)+(1*4)=129
129 % 10 = 9
So 84255-04-9 is a valid CAS Registry Number.
InChI:InChI=1/C28H32N4O4/c29-27(34)17-21-11-13-24(14-12-21)36-20-23(33)19-31(18-22-7-2-1-3-8-22)15-6-16-32-26-10-5-4-9-25(26)30-28(32)35/h1-5,7-14,23,33H,6,15-20H2,(H2,29,34)(H,30,35)