84255-06-1 Usage
Chemical class
Piperazine derivatives
Piperazine ring
A heterocyclic compound with a six-membered ring containing two nitrogen atoms.
Benzhydryl group
A phenyl group connected to another phenyl group through a carbon-carbon single bond, attached to the nitrogen atom of the piperazine ring.
4-[(4-methoxy-3-nitrophenyl)methyl] group
A phenyl group with a methoxy group at the 4th position and a nitro group at the 3rd position, connected to a methylene group (-CH2-) which is attached to one of the carbon atoms of the piperazine ring.
Potential medicinal properties
The compound may have therapeutic applications for various conditions due to its unique structure and functional groups.
Methoxy group
A functional group that can potentially form hydrogen bonds or engage in other interactions with enzymes or receptors.
Nitro group
A functional group that can participate in various chemical reactions and may influence the compound's reactivity, stability, and interactions with biological targets.
Pharmaceutical research and development
The compound's structure and potential interactions with biological targets make it a valuable molecule for further research and development in the pharmaceutical industry.
Applications
As a result of its medicinal properties and potential interactions with biological targets, 1-benzhydryl-4-[(4-methoxy-3-nitrophenyl)methyl]piperazine may be used in the development of new drugs for treating various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 84255-06-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,5 and 5 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 84255-06:
(7*8)+(6*4)+(5*2)+(4*5)+(3*5)+(2*0)+(1*6)=131
131 % 10 = 1
So 84255-06-1 is a valid CAS Registry Number.
InChI:InChI=1/C25H27N3O3/c1-31-24-13-12-20(18-23(24)28(29)30)19-26-14-16-27(17-15-26)25(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-13,18,25H,14-17,19H2,1H3